CymitQuimica logo

CAS 1306739-47-8

:

4-Methyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile

Description:
4-Methyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-triazine framework. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the carbonitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility and reactivity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of nitrogen and carbon atoms within the triazine and pyrazole rings can lead to interesting electronic properties, making it a candidate for further research in medicinal chemistry. Additionally, the compound's stability, reactivity, and interaction with biological targets would depend on its molecular conformation and the presence of substituents, which can affect its pharmacokinetic and pharmacodynamic profiles. Overall, 4-Methyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile represents a class of compounds with potential significance in various chemical and biological fields.
Formula:C13H9N5
InChI:InChI=1S/C13H9N5/c1-9-12(7-14)16-17-13-11(8-15-18(9)13)10-5-3-2-4-6-10/h2-6,8H,1H3
InChI key:InChIKey=MQDNTTOKZQVQLF-UHFFFAOYSA-N
SMILES:CC=1N2C(=C(C=N2)C3=CC=CC=C3)N=NC1C#N
Synonyms:
  • 4-Methyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile
  • Pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile, 4-methyl-8-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.