
CAS 1306739-49-0
:2,2,2-Trichloro-1-(1-methyl-1H-pyrazol-4-yl)ethanone
Description:
2,2,2-Trichloro-1-(1-methyl-1H-pyrazol-4-yl)ethanone is a chemical compound characterized by its unique structure, which includes a trichloroacetyl group and a pyrazole moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and conditions. It is known for its potential applications in various fields, including agrochemicals and pharmaceuticals, due to its biological activity. The presence of the trichloro group contributes to its reactivity, making it a useful intermediate in organic synthesis. Additionally, the pyrazole ring can impart specific pharmacological properties, enhancing its utility in medicinal chemistry. Safety considerations are important when handling this compound, as it may pose risks associated with chlorinated compounds, including toxicity and environmental impact. Proper storage and handling protocols should be followed to mitigate any hazards. Overall, 2,2,2-Trichloro-1-(1-methyl-1H-pyrazol-4-yl)ethanone is a compound of interest for its chemical properties and potential applications in various scientific domains.
Formula:C6H5Cl3N2O
InChI:InChI=1S/C6H5Cl3N2O/c1-11-3-4(2-10-11)5(12)6(7,8)9/h2-3H,1H3
InChI key:InChIKey=NBYGDRQSWHZFKV-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(=O)C1=CN(C)N=C1
Synonyms:- 2,2,2-Trichloro-1-(1-methyl-1H-pyrazol-4-yl)ethanone
- Ethanone, 2,2,2-trichloro-1-(1-methyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.