
CAS 1306739-52-5
:9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-amine
Description:
9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-amine is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a spiro linkage that connects a five-membered and a six-membered ring, contributing to its rigidity and potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The amine functional group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions or biological interactions. Its structural complexity may also indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. The compound's properties, such as solubility, stability, and reactivity, would be influenced by its molecular structure, making it a subject of interest for further research in organic synthesis and drug development.
Formula:C16H24N2O
InChI:InChI=1S/C16H24N2O/c17-15-6-11-19-16(12-15)7-9-18(10-8-16)13-14-4-2-1-3-5-14/h1-5,15H,6-13,17H2
InChI key:InChIKey=ZNUBNUJFQABQLK-UHFFFAOYSA-N
SMILES:NC1CC2(CCN(CC3=CC=CC=C3)CC2)OCC1
Synonyms:- 9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-amine
- 1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.