CAS 1306739-55-8

5-Cyano-1,6-dihydro-4-methyl-6-oxo-3-pyridinecarboxylic acid

Description:

5-Cyano-1,6-dihydro-4-methyl-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), contributing to its acidic properties. The presence of the methyl group (-CH3) and the keto group (C=O) enhances its reactivity and solubility in various solvents. The compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 5-Cyano-1,6-dihydro-4-methyl-6-oxo-3-pyridinecarboxylic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₆N₂O₃

InChI: InChI=1S/C8H6N2O3/c1-4-5(2-9)7(11)10-3-6(4)8(12)13/h3H,1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=MPDUSZMEFYFEBK-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C)C(C(O)=O)=CNC1=O

Synonyms:

• 5-Cyano-1,6-dihydro-4-methyl-6-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-cyano-1,6-dihydro-4-methyl-6-oxo-