CAS 1306739-58-1

N,α-Dimethyl-3-(trifluoromethyl)-1,2,4-oxadiazole-5-methanamine

Description:

N,α-Dimethyl-3-(trifluoromethyl)-1,2,4-oxadiazole-5-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential reactivity and biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. The dimethylamine substituent suggests potential basicity, which could affect its solubility and reactivity in various environments. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure indicates that it could participate in hydrogen bonding due to the amine group, which may play a role in its biological interactions. Additionally, the trifluoromethyl group can impart stability and alter the electronic properties of the molecule, potentially affecting its behavior in chemical reactions. Overall, N,α-Dimethyl-3-(trifluoromethyl)-1,2,4-oxadiazole-5-methanamine represents a class of compounds that may have applications in drug development and materials science, warranting further investigation into its properties and potential uses.

Formula: C₆H₈F₃N₃O

InChI: InChI=1S/C6H8F3N3O/c1-3(10-2)4-11-5(12-13-4)6(7,8)9/h3,10H,1-2H3

InChI key: InChIKey=YTQCAWOTIRJHDK-UHFFFAOYSA-N

SMILES: C(NC)(C)C1=NC(C(F)(F)F)=NO1

Synonyms:

• N,α-Dimethyl-3-(trifluoromethyl)-1,2,4-oxadiazole-5-methanamine
• 1,2,4-Oxadiazole-5-methanamine, N,α-dimethyl-3-(trifluoromethyl)-