
CAS 1306739-71-8
:2,2,2-Trichloro-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethanone
Description:
2,2,2-Trichloro-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethanone is a synthetic organic compound characterized by its complex structure, which includes a trichloroacetyl group and a pyrazole moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and conditions. It is known for its potential applications in various fields, including agrochemicals and pharmaceuticals, due to its biological activity. The presence of the trichloro group contributes to its reactivity and may influence its solubility in organic solvents. The pyrazole ring, which is a five-membered heterocyclic compound, often imparts unique chemical properties, including the ability to participate in various chemical reactions. Safety data indicates that, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 2,2,2-Trichloro-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethanone is a notable compound in chemical research, with specific characteristics that warrant further investigation for its potential uses.
Formula:C8H9Cl3N2O
InChI:InChI=1S/C8H9Cl3N2O/c1-4-6(5(2)13(3)12-4)7(14)8(9,10)11/h1-3H3
InChI key:InChIKey=YRJNSDHSHJFCAP-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(=O)C1=C(C)N(C)N=C1C
Synonyms:- Ethanone, 2,2,2-trichloro-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-
- 2,2,2-Trichloro-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.