CAS 1306739-76-3: 2-[(4-Fluorophenyl)amino]-6-methyl-5-(phenylmethyl)-4(3H)-pyrimidinone

Description: 2-[(4-Fluorophenyl)amino]-6-methyl-5-(phenylmethyl)-4(3H)-pyrimidinone is a synthetic organic compound characterized by its pyrimidinone core structure, which features a fluorophenyl group and a phenylmethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural motifs, which may interact with biological targets. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the amino and methyl groups contribute to its reactivity and potential for forming hydrogen bonds, which can be crucial in biological interactions. As a pyrimidinone derivative, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and industrial settings.

Formula: C₁₈H₁₆FN₃O

InChI: InChI=1S/C18H16FN3O/c1-12-16(11-13-5-3-2-4-6-13)17(23)22-18(20-12)21-15-9-7-14(19)8-10-15/h2-10H,11H2,1H3,(H2,20,21,22,23)

InChI key: InChIKey=HNGAHJAMUUZQIO-UHFFFAOYSA-N

SMILES: O=C1N=C(NC2=CC=C(F)C=C2)NC(=C1CC=3C=CC=CC3)C

5-benzyl-2-[(4-fluorophenyl)amino]-6-methylpyrimidin-4(3H)-one

CAS: 1306739-76-3

• Molecular weight: 309.343994140625

5-Benzyl-2-[(4-fluorophenyl)amino]-6-methylpyrimidin-4(3H)-one

CAS: 1306739-76-3

Please enquire for more information about 5-Benzyl-2-[(4-fluorophenyl)amino]-6-methylpyrimidin-4(3H)-one including the price, delivery time and more detailed …

• Formula: C₁₈H₁₆FN₃O
• Purity: Min. 95%
• Molecular weight: 309.34 g/mol