CAS 1306739-83-2
:3,4-Dihydro-3-(2-phenylethyl)-1,3,5-triazino[1,2-a]benzimidazole-1(2H)-ethanol
Description:
3,4-Dihydro-3-(2-phenylethyl)-1,3,5-triazino[1,2-a]benzimidazole-1(2H)-ethanol is a complex organic compound characterized by its unique triazino-benzimidazole structure, which contributes to its potential biological activity. This compound features a triazine ring fused to a benzimidazole moiety, providing a diverse range of chemical properties. The presence of the 2-phenylethyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The hydroxyl group in the ethanol portion may contribute to hydrogen bonding capabilities, affecting solubility and reactivity. This compound is of interest in medicinal chemistry due to its structural features that may exhibit pharmacological properties, including anti-cancer or anti-inflammatory activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to elucidate its mechanism of action and potential therapeutic applications.
Formula:C19H22N4O
InChI:InChI=1S/C19H22N4O/c24-13-12-22-14-21(11-10-16-6-2-1-3-7-16)15-23-18-9-5-4-8-17(18)20-19(22)23/h1-9,24H,10-15H2
InChI key:InChIKey=ZZQJQHUOKKNPAN-UHFFFAOYSA-N
SMILES:C(CO)N1C=2N(C=3C(N2)=CC=CC3)CN(CCC4=CC=CC=C4)C1
Synonyms:- 3,4-Dihydro-3-(2-phenylethyl)-1,3,5-triazino[1,2-a]benzimidazole-1(2H)-ethanol
- 1,3,5-Triazino[1,2-a]benzimidazole-1(2H)-ethanol, 3,4-dihydro-3-(2-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.