CymitQuimica logo

CAS 1306739-84-3

:

2-[2-(6-Chloro-2-benzoxazolyl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[2-(6-Chloro-2-benzoxazolyl)ethyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 1306739-84-3, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole core and a benzoxazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. Additionally, the isoindole structure is known for its involvement in various pharmacological activities, including anti-inflammatory and anticancer properties. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Overall, this substance represents a class of compounds that may have significant implications in therapeutic applications, warranting further investigation into its biological effects and mechanisms of action.
Formula:C17H11ClN2O3
InChI:InChI=1S/C17H11ClN2O3/c18-10-5-6-13-14(9-10)23-15(19-13)7-8-20-16(21)11-3-1-2-4-12(11)17(20)22/h1-6,9H,7-8H2
InChI key:InChIKey=VIXRNPUVWHFAHK-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC3=NC=4C(O3)=CC(Cl)=CC4)=CC=CC2
Synonyms:
  • 2-[2-(6-Chloro-2-benzoxazolyl)ethyl]-1H-isoindole-1,3(2H)-dione
  • 1H-Isoindole-1,3(2H)-dione, 2-[2-(6-chloro-2-benzoxazolyl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.