CymitQuimica logo

CAS 1306739-85-4

:

2-[[5-[[(4-Chlorophenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide

Description:
2-[[5-[[(4-Chlorophenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a triazole ring, a thioether linkage, and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and triazoles, such as potential biological activity, including antimicrobial or antifungal effects, due to the presence of the triazole moiety. The chlorophenyl group may enhance lipophilicity, influencing its solubility and bioavailability. The thioether linkage can contribute to the compound's stability and reactivity, making it a candidate for various chemical reactions. Additionally, the presence of the hydrazide functional group suggests potential for further derivatization, which could be explored for medicinal chemistry applications. Overall, this compound's unique structural features may lead to diverse applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require empirical investigation.
Formula:C17H17ClN6OS
InChI:InChI=1S/C17H17ClN6OS/c18-12-6-8-13(9-7-12)20-10-15-22-23-17(26-11-16(25)21-19)24(15)14-4-2-1-3-5-14/h1-9,20H,10-11,19H2,(H,21,25)
InChI key:InChIKey=ULHIEAKNSGNAPI-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Cl)C=C1)C=2N(C(SCC(NN)=O)=NN2)C3=CC=CC=C3
Synonyms:
  • 2-[[5-[[(4-Chlorophenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
  • Acetic acid, 2-[[5-[[(4-chlorophenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.