CAS 1306739-90-1

2-[(3,4-Dimethylphenyl)amino]-5,6-dimethyl-4(3H)-pyrimidinone

Description:

2-[(3,4-Dimethylphenyl)amino]-5,6-dimethyl-4(3H)-pyrimidinone, identified by its CAS number 1306739-90-1, is a chemical compound characterized by its pyrimidinone core structure, which features a substituted amino group and multiple methyl groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the dimethylphenyl group suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may possess lipophilic characteristics, which can influence its solubility and permeability in biological systems. Additionally, the specific arrangement of methyl groups can affect its steric and electronic properties, potentially impacting its reactivity and interaction with other molecules. Overall, this compound may be explored for applications in pharmaceuticals or agrochemicals, although detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₄H₁₇N₃O

InChI: InChI=1S/C14H17N3O/c1-8-5-6-12(7-9(8)2)16-14-15-11(4)10(3)13(18)17-14/h5-7H,1-4H3,(H2,15,16,17,18)

InChI key: InChIKey=XLZOAIQEJKGKCB-UHFFFAOYSA-N

SMILES: N(C=1NC(C)=C(C)C(=O)N1)C2=CC(C)=C(C)C=C2

Synonyms:

• 2-[(3,4-Dimethylphenyl)amino]-5,6-dimethyl-4(3H)-pyrimidinone
• 4(3H)-Pyrimidinone, 2-[(3,4-dimethylphenyl)amino]-5,6-dimethyl-