CymitQuimica logo

CAS 1306739-92-3

:

4-(3-Cyclohexen-1-yl)-1,4-dihydro-1,3,5-triazino[1,2-a]benzimidazol-2-amine

Description:
4-(3-Cyclohexen-1-yl)-1,4-dihydro-1,3,5-triazino[1,2-a]benzimidazol-2-amine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a triazine and benzimidazole moiety. This compound features a cyclohexenyl substituent that contributes to its structural diversity and potential reactivity. The presence of the triazine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The dihydro form indicates that the compound may exhibit specific stereochemical properties, influencing its biological activity and solubility. Additionally, the amine functional group can participate in hydrogen bonding, enhancing its interactions with other molecules. Overall, this compound's intricate structure and functional groups make it a candidate for further research in drug development and materials science, although specific biological activities and applications would require empirical investigation.
Formula:C15H17N5
InChI:InChI=1S/C15H17N5/c16-14-18-13(10-6-2-1-3-7-10)20-12-9-5-4-8-11(12)17-15(20)19-14/h1-2,4-5,8-10,13H,3,6-7H2,(H3,16,17,18,19)
InChI key:InChIKey=BBDJTVWJDLONIW-UHFFFAOYSA-N
SMILES:NC1=NC(N2C=3C(NC2=N1)=CC=CC3)C4CCC=CC4
Synonyms:
  • 4-(3-Cyclohexen-1-yl)-1,4-dihydro-1,3,5-triazino[1,2-a]benzimidazol-2-amine
  • 4-Cyclohex-3-enyl-1,4-dihydro-benzo[4,5]imidazo[1,2-a][1,3,5]triazin-2-ylamine
  • 1,3,5-Triazino[1,2-a]benzimidazol-2-amine, 4-(3-cyclohexen-1-yl)-1,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.