
CAS 130675-15-9
:Octanal, 3-ethenyl-7-hydroxy-3,7-dimethyl-, (R)-
Description:
Octanal, 3-ethenyl-7-hydroxy-3,7-dimethyl-, (R)-, with the CAS number 130675-15-9, is an organic compound characterized by its specific structural features. It belongs to the class of aldehydes and is notable for containing a long carbon chain, which contributes to its hydrophobic properties. The presence of a hydroxyl group (-OH) indicates that it has alcohol characteristics, which can enhance its solubility in polar solvents. The ethenyl group suggests that it has unsaturation, which can influence its reactivity and potential for polymerization. The (R)- designation indicates that the compound has a specific stereochemistry, which can affect its biological activity and interactions with other molecules. This compound may be of interest in various fields, including fragrance formulation, as it can impart specific olfactory characteristics, and in organic synthesis, where its functional groups can serve as reactive sites for further chemical transformations. Overall, its unique combination of functional groups and stereochemistry makes it a compound of interest in both industrial and research applications.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-5-12(4,9-10-13)8-6-7-11(2,3)14/h5,10,14H,1,6-9H2,2-4H3/t12-/m1/s1
InChI key:InChIKey=RMSSTDDQDYGBHH-GFCCVEGCSA-N
SMILES:[C@](CCCC(C)(C)O)(CC=O)(C=C)C
Synonyms:- (r)-7-Hydroxy-3,7-dimethyl-3-vinyl-octanal
- Octanal, 3-ethenyl-7-hydroxy-3,7-dimethyl-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
