CymitQuimica logo

CAS 130675-16-0

:

1,7-Octanediol, 3-ethenyl-1-(4-methoxyphenyl)-3,7-dimethyl-, [R-(R*,R*)]-

Description:
1,7-Octanediol, 3-ethenyl-1-(4-methoxyphenyl)-3,7-dimethyl-, [R-(R*,R*)]- is a complex organic compound characterized by its long carbon chain and multiple functional groups. It features a diol structure, indicating the presence of two hydroxyl (-OH) groups, which contribute to its solubility in polar solvents and potential for hydrogen bonding. The compound also contains a vinyl group (ethenyl), which can participate in polymerization reactions, making it useful in various synthetic applications. The presence of a methoxyphenyl group enhances its aromatic characteristics, potentially influencing its reactivity and interaction with other molecules. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic carbon chain, while the hydroxyl groups provide some degree of hydrophilicity. Its stereochemistry, indicated by the [R-(R*,R*)] notation, suggests specific spatial arrangements that can affect its biological activity and interactions. Overall, this compound may find applications in fields such as materials science, pharmaceuticals, and organic synthesis due to its unique structural features.
Formula:C19H30O3
InChI:InChI=1S/C19H30O3/c1-6-19(4,13-7-12-18(2,3)21)14-17(20)15-8-10-16(22-5)11-9-15/h6,8-11,17,20-21H,1,7,12-14H2,2-5H3/t17-,19-/m1/s1
InChI key:InChIKey=BNSRMGLMWXGBOT-IEBWSBKVSA-N
SMILES:[C@@](C[C@@H](O)C1=CC=C(OC)C=C1)(CCCC(C)(C)O)(C=C)C
Synonyms:
  • 1,7-Octanediol, 3-ethenyl-1-(4-methoxyphenyl)-3,7-dimethyl-, [R-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.