CAS 1306753-49-0
:3-(Dimethylamino)-1-[4-(3-methylbutoxy)phenyl]-2-propen-1-one
Description:
3-(Dimethylamino)-1-[4-(3-methylbutoxy)phenyl]-2-propen-1-one, identified by its CAS number 1306753-49-0, is an organic compound characterized by its complex structure, which includes a dimethylamino group and a propenone moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of a phenyl ring and a branched alkoxy substituent. It is likely to be a yellow to orange solid or liquid, depending on its purity and specific conditions. The dimethylamino group can impart basic characteristics, making the compound potentially soluble in polar solvents. Additionally, the presence of the propenone functional group suggests that it may participate in various chemical reactions, including Michael additions and condensation reactions. Its unique structure may also confer interesting photophysical properties, making it a candidate for applications in organic electronics or as a dye. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C16H23NO2
InChI:InChI=1S/C16H23NO2/c1-13(2)10-12-19-15-7-5-14(6-8-15)16(18)9-11-17(3)4/h5-9,11,13H,10,12H2,1-4H3
InChI key:InChIKey=GFDZNTYIOUTANF-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC=C(OCCC(C)C)C=C1
Synonyms:- 3-(Dimethylamino)-1-[4-(3-methylbutoxy)phenyl]-2-propen-1-one
- 2-Propen-1-one, 3-(dimethylamino)-1-[4-(3-methylbutoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.