CAS 1306753-51-4

Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate

Description:

Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate is a complex organic compound characterized by its unique pyrazolo-triazine structure, which incorporates multiple functional groups. This compound features a methyl ester group, contributing to its solubility in organic solvents, and a dimethylamino group that may enhance its reactivity and potential biological activity. The presence of ethyl and phenyl substituents suggests that it may exhibit interesting electronic properties and steric effects, which can influence its interactions in chemical reactions or biological systems. The compound's structure indicates potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the triazine moiety, which is often associated with herbicidal activity. Additionally, the specific arrangement of substituents may impart unique optical or electronic characteristics, making it a candidate for further research in material science or medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of modern organic synthesis and its potential applications in various fields.

Formula: C₁₉H₂₁N₅O₂

InChI: InChI=1S/C19H21N5O2/c1-5-14-16(13-9-7-6-8-10-13)18-21-20-17(19(25)26-4)15(24(18)22-14)11-12-23(2)3/h6-12H,5H2,1-4H3

InChI key: InChIKey=ARXWCVBLYPHVTR-UHFFFAOYSA-N

SMILES: C(C)C=1C(=C2N(N1)C(C=CN(C)C)=C(C(OC)=O)N=N2)C3=CC=CC=C3

Synonyms:

• Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate
• Pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid, 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-phenyl-, methyl ester