CAS 1306753-56-9

Ethyl 4-[2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate

Description:

Ethyl 4-[2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-triazine framework. This compound features an ethyl ester functional group and a dimethylamino substituent, contributing to its potential biological activity. The presence of the pyrazolo and triazine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biochemical pathways. Its molecular structure indicates potential for interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its stability may vary depending on environmental conditions such as pH and temperature. As with many synthetic compounds, safety data regarding toxicity and handling should be consulted before use in laboratory or industrial settings. Overall, this compound represents a class of molecules that could be explored for their therapeutic potential in drug development.

Formula: C₁₂H₁₅N₅O₂

InChI: InChI=1S/C12H15N5O2/c1-4-19-12(18)11-9(6-8-16(2)3)17-10(14-15-11)5-7-13-17/h5-8H,4H2,1-3H3

InChI key: InChIKey=MCIUELUWDLMDEO-UHFFFAOYSA-N

SMILES: C(=CN(C)C)C=1N2C(N=NC1C(OCC)=O)=CC=N2

Synonyms:

• Pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid, 4-[2-(dimethylamino)ethenyl]-, ethyl ester
• Ethyl 4-[2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate