CymitQuimica logo

CAS 1306753-58-1

:

1-[7-[2-(Dimethylamino)ethenyl]-2-(methoxymethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone

Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-(methoxymethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1306753-58-1, is a chemical compound characterized by its complex structure, which includes a triazolo-pyrimidine core and a dimethylamino group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its nitrogen-containing rings. The presence of the dimethylamino group suggests it may have basic properties, which can influence its solubility and reactivity. Additionally, the methoxymethyl substituent may enhance its lipophilicity, potentially affecting its pharmacokinetics if it is evaluated for medicinal purposes. The compound's structure indicates it may interact with biological targets, making it of interest in pharmaceutical research. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of molecules that may have significant applications in medicinal chemistry and drug development.
Formula:C13H17N5O2
InChI:InChI=1S/C13H17N5O2/c1-9(19)10-7-14-13-15-12(8-20-4)16-18(13)11(10)5-6-17(2)3/h5-7H,8H2,1-4H3
InChI key:InChIKey=NJFKNWBQIXBURS-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(COC)=N2)N=CC1C(C)=O
Synonyms:
  • 1-[7-[2-(Dimethylamino)ethenyl]-2-(methoxymethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
  • Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-(methoxymethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.