CAS 1306753-61-6
:Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-(4-fluorophenyl)pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate
Description:
Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-(4-fluorophenyl)pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate is a complex organic compound characterized by its unique pyrazolo-triazine structure, which incorporates multiple functional groups. This substance features a methyl ester group, contributing to its solubility and reactivity. The presence of a dimethylamino group suggests potential basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions. The ethyl and fluorophenyl substituents enhance its lipophilicity and may influence its biological activity. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its intricate arrangement of heterocycles and functional groups. Additionally, the fluorine atom can enhance metabolic stability and bioactivity. Overall, this compound's characteristics suggest it may exhibit interesting chemical behavior and potential therapeutic properties, warranting further investigation in both synthetic and biological contexts.
Formula:C19H20FN5O2
InChI:InChI=1S/C19H20FN5O2/c1-5-14-16(12-6-8-13(20)9-7-12)18-22-21-17(19(26)27-4)15(25(18)23-14)10-11-24(2)3/h6-11H,5H2,1-4H3
InChI key:InChIKey=PFDQHCZZUNVQKX-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=C(C(CC)=N2)C3=CC=C(F)C=C3)N=NC1C(OC)=O
Synonyms:- Pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid, 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-(4-fluorophenyl)-, methyl ester
- Methyl 4-[2-(dimethylamino)ethenyl]-7-ethyl-8-(4-fluorophenyl)pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.