CAS 1306753-63-8
:1-[7-[2-(Dimethylamino)ethenyl]-2-(ethylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-(ethylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone is a complex organic compound characterized by its unique structural features, which include a triazolo-pyrimidine core and a dimethylamino group. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential biological activity, given the presence of nitrogen-containing rings. The ethylthio group may contribute to its lipophilicity, influencing its solubility and permeability in biological systems. The presence of the dimethylamino group suggests potential interactions with biological targets, possibly enhancing its pharmacological profile. Additionally, the ethanone moiety indicates that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Overall, this compound's intricate structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific data regarding its physical properties, reactivity, and biological activity would require further investigation through experimental studies.
Formula:C13H17N5OS
InChI:InChI=1S/C13H17N5OS/c1-5-20-13-15-12-14-8-10(9(2)19)11(18(12)16-13)6-7-17(3)4/h6-8H,5H2,1-4H3
InChI key:InChIKey=XUTQIUHRSJJMGG-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(SCC)=N2)N=CC1C(C)=O
Synonyms:- Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-(ethylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
- 1-[7-[2-(Dimethylamino)ethenyl]-2-(ethylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
- 1-[7-(2-Dimethylamino-vinyl)-2-ethylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-ethanone
- 1-[7-[(E)-2-(Dimethylamino)vinyl]-2-(ethylthio)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.