CAS 1306753-65-0
:1-[7-[2-(Dimethylamino)ethenyl]-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1306753-65-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazolo-pyrimidine core. This compound features a dimethylamino group, which is known for its basicity and potential to participate in various chemical reactions, as well as a methylthio group that can influence its electronic properties and reactivity. The presence of the ethenyl group suggests potential for conjugation, which may enhance its stability and reactivity in certain conditions. The ethanone moiety indicates that the compound may exhibit ketone-like properties, potentially influencing its solubility and interaction with other molecules. Overall, this compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could confer specific biological activities or pharmacological effects. Further studies would be necessary to elucidate its precise characteristics and potential applications.
Formula:C12H15N5OS
InChI:InChI=1S/C12H15N5OS/c1-8(18)9-7-13-11-14-12(19-4)15-17(11)10(9)5-6-16(2)3/h5-7H,1-4H3
InChI key:InChIKey=NVPWYWYTHNOZJC-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(SC)=N2)N=CC1C(C)=O
Synonyms:- 1-[7-[2-(Dimethylamino)ethenyl]-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
- Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.