CAS 1306753-66-1
:4-[2-(Dimethylamino)ethenyl]-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile
Description:
4-[2-(Dimethylamino)ethenyl]-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile is a complex organic compound characterized by its unique structural features, including a pyrazolo-triazine core and a dimethylamino substituent. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for many heterocyclic compounds. Its structure suggests potential applications in fields like pharmaceuticals or agrochemicals, particularly due to the presence of the triazine moiety, which is known for its biological activity. The dimethylamino group may enhance its reactivity and influence its interaction with biological targets. Additionally, the presence of a phenyl group can contribute to its electronic properties and stability. The compound's carbonitrile functional group may also impart specific chemical reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable substance in various chemical applications.
Formula:C16H14N6
InChI:InChI=1S/C16H14N6/c1-21(2)9-8-15-14(10-17)19-20-16-13(11-18-22(15)16)12-6-4-3-5-7-12/h3-9,11H,1-2H3
InChI key:InChIKey=IDCKAAMJPARHBL-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=C(C=N2)C3=CC=CC=C3)N=NC1C#N
Synonyms:- 4-[2-(Dimethylamino)ethenyl]-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile
- Pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile, 4-[2-(dimethylamino)ethenyl]-8-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.