CymitQuimica logo

CAS 1306753-69-4

:

N′-(3-Cyanopyrazolo[5,1-c][1,2,4]triazin-4-yl)-N,N-dimethylmethanimidamide

Description:
N′-(3-Cyanopyrazolo[5,1-c][1,2,4]triazin-4-yl)-N,N-dimethylmethanimidamide is a chemical compound characterized by its complex structure, which includes a pyrazolo-triazine core and a dimethylmethanimidamide moiety. This compound features a cyano group, which contributes to its potential reactivity and interaction with biological targets. The presence of the triazine ring suggests that it may exhibit interesting electronic properties, potentially making it a candidate for various applications in medicinal chemistry or as a research tool in biochemistry. Its molecular structure indicates that it may engage in hydrogen bonding and other intermolecular interactions, which could influence its solubility and stability in different environments. Additionally, the dimethylamino group may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's unique structural features may provide avenues for further exploration in drug development or as a chemical probe in scientific research.
Formula:C9H9N7
InChI:InChI=1S/C9H9N7/c1-15(2)6-11-9-7(5-10)13-14-8-3-4-12-16(8)9/h3-4,6H,1-2H3
InChI key:InChIKey=HWZDNJBEAPVJPG-UHFFFAOYSA-N
SMILES:N(=CN(C)C)C=1N2C(N=NC1C#N)=CC=N2
Synonyms:
  • Methanimidamide, N′-(3-cyanopyrazolo[5,1-c][1,2,4]triazin-4-yl)-N,N-dimethyl-
  • N′-(3-Cyanopyrazolo[5,1-c][1,2,4]triazin-4-yl)-N,N-dimethylmethanimidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.