CymitQuimica logo

CAS 1306753-70-7

:

1-[7-[2-(Dimethylamino)ethenyl]-2-ethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone

Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-ethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1306753-70-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazolo-pyrimidine core and a dimethylamino group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the dimethylamino group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Its unique structural features may contribute to specific reactivity patterns, stability under various conditions, and interactions with other chemical entities. As with many compounds in this class, understanding its characteristics requires consideration of its molecular interactions, potential applications, and safety profiles in both laboratory and therapeutic contexts. Further studies would be necessary to elucidate its full range of properties and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H17N5O
InChI:InChI=1S/C13H17N5O/c1-5-12-15-13-14-8-10(9(2)19)11(18(13)16-12)6-7-17(3)4/h6-8H,5H2,1-4H3
InChI key:InChIKey=GUYJQLLDORLEPY-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(CC)=N2)N=CC1C(C)=O
Synonyms:
  • 1-[7-[2-(Dimethylamino)ethenyl]-2-ethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
  • Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-ethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.