CymitQuimica logo

CAS 1306753-72-9

:

1-[7-[2-(Dimethylamino)ethenyl]-2-(4-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone

Description:
1-[7-[2-(Dimethylamino)ethenyl]-2-(4-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1306753-72-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a triazolo-pyrimidine core and a dimethylamino group. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for many nitrogen-containing heterocycles. Its structure suggests potential biological activity, particularly in medicinal chemistry, where similar compounds have been explored for their roles as pharmaceuticals, potentially acting as enzyme inhibitors or receptor modulators. The presence of the pyridine and triazole rings may contribute to its ability to interact with biological targets. Additionally, the dimethylamino group can enhance lipophilicity, influencing the compound's pharmacokinetics. Overall, this compound's unique structural features may provide avenues for research in drug development and therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C16H16N6O
InChI:InChI=1S/C16H16N6O/c1-11(23)13-10-18-16-19-15(12-4-7-17-8-5-12)20-22(16)14(13)6-9-21(2)3/h4-10H,1-3H3
InChI key:InChIKey=GJCNCBHFZFFNGG-UHFFFAOYSA-N
SMILES:C(=CN(C)C)C=1N2C(=NC(=N2)C=3C=CN=CC3)N=CC1C(C)=O
Synonyms:
  • 1-[7-[2-(Dimethylamino)ethenyl]-2-(4-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
  • Ethanone, 1-[7-[2-(dimethylamino)ethenyl]-2-(4-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.