CAS 1306753-73-0

Ethyl 7-[2-(dimethylamino)ethenyl]-2-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate

Description:

Ethyl 7-[2-(dimethylamino)ethenyl]-2-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate is a complex organic compound characterized by its unique structural features, which include a triazolo-pyrimidine core and a pyridine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the dimethylamino group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. The ethyl ester functional group may enhance its lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the compound's structure may allow for various chemical modifications, which can be explored for optimizing its therapeutic efficacy. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development, particularly in areas targeting specific biological pathways. Further studies would be necessary to elucidate its full range of chemical and biological properties.

Formula: C₁₇H₁₈N₆O₂

InChI: InChI=1S/C17H18N6O2/c1-4-25-16(24)13-11-19-17-20-15(12-6-5-8-18-10-12)21-23(17)14(13)7-9-22(2)3/h5-11H,4H2,1-3H3

InChI key: InChIKey=SDQVJGJMOASFOG-UHFFFAOYSA-N

SMILES: C(=CN(C)C)C=1N2C(=NC(=N2)C=3C=CC=NC3)N=CC1C(OCC)=O

Synonyms:

• Ethyl 7-[2-(dimethylamino)ethenyl]-2-(3-pyridinyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate
• [1,2,4]Triazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-[2-(dimethylamino)ethenyl]-2-(3-pyridinyl)-, ethyl ester