CAS 1306753-75-2

2-(Dimethoxymethyl)-N-hydroxybenzenecarboximidamide

Description:

2-(Dimethoxymethyl)-N-hydroxybenzenecarboximidamide is a chemical compound characterized by its unique functional groups and structural features. It contains a benzenecarboximidamide moiety, which is indicative of its potential biological activity, particularly in medicinal chemistry. The presence of a hydroxylamine group (N-hydroxy) suggests that it may participate in various chemical reactions, including those involving nucleophilic attack or redox processes. The dimethoxymethyl substituent enhances its solubility and may influence its interaction with biological targets. This compound may exhibit properties such as being a potential inhibitor or modulator in biochemical pathways, making it of interest in pharmaceutical research. Its molecular structure allows for various stereochemical configurations, which can affect its reactivity and biological activity. Overall, the characteristics of this compound suggest it could have applications in drug development or as a research tool in understanding specific biochemical processes. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₀H₁₄N₂O₃

InChI: InChI=1S/C10H14N2O3/c1-14-10(15-2)8-6-4-3-5-7(8)9(11)12-13/h3-6,10,13H,1-2H3,(H2,11,12)

InChI key: InChIKey=UHVXXDFSWOCZMO-UHFFFAOYSA-N

SMILES: C(OC)(OC)C1=C(C(NO)=N)C=CC=C1

Synonyms:

• Benzenecarboximidamide, 2-(dimethoxymethyl)-N-hydroxy-
• 2-(Dimethoxymethyl)-N-hydroxybenzenecarboximidamide