CAS 130676-66-3: (2S,3S,5S)-5-[(N-Formyl-L-leucyl)oxy]-2-hexyl-3-hydroxyhexadecanoic Acid (Orlistat Impurity)
Description:The chemical substance known as (2S,3S,5S)-5-[(N-Formyl-L-leucyl)oxy]-2-hexyl-3-hydroxyhexadecanoic Acid, with the CAS number 130676-66-3, is an impurity associated with the weight-loss drug Orlistat. This compound features a complex structure characterized by multiple stereocenters, which contribute to its specific three-dimensional arrangement. It contains a long hydrocarbon chain, indicative of its lipophilic nature, which is typical for compounds that interact with biological membranes. The presence of a hydroxyl group suggests potential for hydrogen bonding, influencing its solubility and reactivity. Additionally, the N-formyl-L-leucyl moiety indicates that it may participate in peptide-like interactions, which could affect its biological activity. As an impurity, it is essential to monitor this compound in pharmaceutical formulations to ensure safety and efficacy, as impurities can impact the pharmacokinetics and pharmacodynamics of the primary drug. Understanding its characteristics is crucial for quality control in drug development and manufacturing processes.
Formula:C29H55NO6
InChI:InChI=1/C29H55NO6/c1-5-7-9-11-12-13-14-15-16-18-24(36-29(35)26(30-22-31)20-23(3)4)21-27(32)25(28(33)34)19-17-10-8-6-2/h22-27,32H,5-21H2,1-4H3,(H,30,31)(H,33,34)/t24-,25-,26?,27-/m0/s1
- Synonyms:
- N-Formyl-L-leucine (1S)-1-[(2S,3S)-3-carboxy-2-hydroxynonyl]dodecyl Ester
- [2R-[1(S*),2R*,3S*]]- N-Formyl-L-Leucine 1-[3-Carboxy-2-hydroxynonyl]dodecyl Ester
- (S)-3-Hexyl-5,6-dihydro-6-undecyl-2H-pyran-2-one