CAS 130687-25-1

2-Pyrimidinamine, 4-fluoro-6-methoxy-

Description:

2-Pyrimidinamine, 4-fluoro-6-methoxy- is an organic compound characterized by a pyrimidine ring substituted with an amino group, a fluorine atom, and a methoxy group. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions. The fluorine atom introduces unique electronic properties, enhancing the compound's reactivity and potentially influencing its biological activity. The methoxy group (-OCH3) is an electron-donating substituent that can affect the compound's solubility and stability. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Pyrimidinamine, 4-fluoro-6-methoxy- represents a class of compounds that can be explored for various chemical and biological applications.

Formula: C₅H₆FN₃O

InChI: InChI=1/C5H6FN3O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3,(H2,7,8,9)

SMILES: COc1cc(F)[nH]c(=N)n1

Synonyms:

• 4-Fluoro-6-methoxy-2-pyrimidinamine
• 4-Fluoro-6-Methoxypyrimidin-2-Amine

4-Fluoro-6-methoxypyrimidin-2-amine

CAS: 130687-25-1

Formula: C₅H₆FN₃O

Purity: %

Color and Shape: Solid

Molecular weight: 143.1190

Ref: IN-DA000UTK

4-Fluoro-6-methoxypyrimidin-2-amine

CAS: 130687-25-1

Formula: C₅H₆FN₃O

Purity: 95.0%

Molecular weight: 143.121

Ref: 10-F321351