CAS 13070-25-2
:2-Bromo-5-methyl-1,4-benzoquinone
Description:
2-Bromo-5-methyl-1,4-benzoquinone is an organic compound characterized by its quinone structure, which features a six-membered aromatic ring with two carbonyl groups. The presence of a bromine atom at the 2-position and a methyl group at the 5-position contributes to its unique reactivity and properties. This compound is typically a yellow to orange solid, indicating its conjugated system, which can absorb visible light. It is known for its role in organic synthesis and as an intermediate in various chemical reactions, particularly in the formation of more complex molecules. The bromine substituent can enhance electrophilic reactivity, making it useful in substitution reactions. Additionally, 2-bromo-5-methyl-1,4-benzoquinone may exhibit biological activity, which can be of interest in medicinal chemistry. Its solubility is generally limited in water but may dissolve in organic solvents, reflecting its hydrophobic nature. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.
Formula:C7H5BrO2
InChI:InChI=1/C7H5BrO2/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3
SMILES:CC1=CC(=O)C(=CC1=O)Br
Synonyms:- 2-Bromo-5-Methylcyclohexa-2,5-Diene-1,4-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
