CAS 13070-53-6
:Ethyl 3-(ethylamino)crotonate
Description:
Ethyl 3-(ethylamino)crotonate, with the CAS number 13070-53-6, is an organic compound characterized by its ester functional group and an amino group. It features a crotonate backbone, which is derived from crotonic acid, and an ethylamino substituent that contributes to its reactivity and potential biological activity. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. Ethyl 3-(ethylamino)crotonate is soluble in organic solvents, which enhances its utility in various chemical reactions and applications. It may participate in nucleophilic addition reactions due to the presence of the amino group, making it of interest in synthetic organic chemistry. Additionally, its structure suggests potential applications in pharmaceuticals or agrochemicals, where such compounds can serve as intermediates or active ingredients. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-4-9-7(3)6-8(10)11-5-2/h6,9H,4-5H2,1-3H3/b7-6-
SMILES:CCN/C(=C\C(=O)OCC)/C
Synonyms:- 3-Ethylamino-but-2-enoic acid ethyl ester
- Ethyl 3-(Ethylamino)But-2-Enoate
- ethyl (2E)-3-(ethylamino)but-2-enoate
- ethyl (2Z)-3-(ethylamino)but-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
