CymitQuimica logo

CAS 13071-14-2

:

5-(4-Methoxyphenylazo)-8-hydroxyquinoline

Description:
5-(4-Methoxyphenylazo)-8-hydroxyquinoline, with the CAS number 13071-14-2, is an organic compound characterized by its azo group, which is a functional group featuring a nitrogen-nitrogen double bond (–N=N–). This compound typically exhibits a vibrant color due to the presence of the azo linkage, making it useful as a dye or pigment. The hydroxyquinoline moiety contributes to its potential applications in coordination chemistry, as it can form chelates with metal ions. The methoxyphenyl group enhances its solubility and stability in various solvents. This compound may also exhibit biological activity, including antimicrobial or antifungal properties, owing to the presence of the hydroxyquinoline structure. Its synthesis often involves coupling reactions, and it can be analyzed using techniques such as UV-Vis spectroscopy, which can help in studying its electronic transitions and stability. Overall, 5-(4-Methoxyphenylazo)-8-hydroxyquinoline is notable for its colorimetric properties and potential applications in various fields, including materials science and biochemistry.
Formula:C16H13N3O2
InChI:InChI=1S/C16H13N3O2/c1-21-12-6-4-11(5-7-12)18-19-14-8-9-15(20)16-13(14)3-2-10-17-16/h2-10,20H,1H3
InChI key:InChIKey=LEJMWBSDWKDHTF-UHFFFAOYSA-N
SMILES:N(=NC1=CC=C(OC)C=C1)C=2C3=C(C(O)=CC2)N=CC=C3
Synonyms:
  • 8-Quinolinol, 5-[2-(4-methoxyphenyl)diazenyl]-
  • 8-Quinolinol, 5-[(p-methoxyphenyl)azo]-
  • 8-Quinolinol, 5-[(4-methoxyphenyl)azo]-
  • 5-[2-(4-Methoxyphenyl)diazenyl]-8-quinolinol
  • 5-(p-Anisylazo)-8-quinolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.