CAS 13072-69-0
:1-Adamantylurea
Description:
1-Adamantylurea is an organic compound characterized by its unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. The compound features a urea functional group, which consists of a carbonyl group (C=O) bonded to two amine groups (NH2). This structure imparts specific chemical properties, including the ability to form hydrogen bonds, which can influence its solubility and reactivity. 1-Adamantylurea is typically a white crystalline solid at room temperature and is soluble in polar solvents. It has applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. The compound's stability and unique steric properties make it an interesting subject for research in various fields, including materials science and drug design. Additionally, its derivatives may exhibit enhanced pharmacological effects, making it a valuable compound in the exploration of new therapeutic agents.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14)
InChI key:InChIKey=QYYHPAUOLCHORH-UHFFFAOYSA-N
SMILES:N(C(N)=O)C12CC3CC(C1)CC(C2)C3
Synonyms:- Urea, N-tricyclo[3.3.1.13,7]dec-1-yl-
- Urea, tricyclo[3.3.1.13,7]dec-1-yl-
- 1-Adamantylurea
- N-Tricyclo[3.3.1.13,7]dec-1-ylurea
- Urea, (1-adamantyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Urea, N-tricyclo[3.3.1.13,7]dec-1-yl-
CAS:Formula:C11H18N2OPurity:95%Color and Shape:SolidMolecular weight:194.2734N-(1-Adamantyl)-urea
CAS:Adamantyl urea is a compound that has been shown to have inhibitory properties on the growth of myeloma cells. Adamantyl urea has been shown to inhibit the transfer reactions of nuclear DNA and mitochondrial functions in vitro assays. Adamantyl urea also inhibited the growth of wild-type strains, but not resistant mutants, which may be due to its ability to inhibit the synthesis of nucleic acids or proteins. This agent also inhibits dextran sulfate and rutamycin, which may indicate that it acts by inhibiting structural analysis or diagnosis. Adamantyl urea is being studied for use as an anti-cancer drug in vivo models.
Purity:Min. 95%Color and Shape:PowderMolecular weight:194.27 g/molRef: 3D-FA03014
Discontinued product



