CAS 130723-13-6
:3-Bromo-5-fluorobenzotrifluoride
Description:
3-Bromo-5-fluorobenzotrifluoride is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and three trifluoromethyl groups attached to a benzene ring. Its molecular structure features a bromine substituent at the meta position and a fluorine substituent at the para position relative to one of the trifluoromethyl groups. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its stability and relatively low reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of multiple electronegative halogens contributes to its unique electronic properties, influencing its reactivity and interactions with other chemical species. Additionally, 3-Bromo-5-fluorobenzotrifluoride is subject to regulations regarding its handling and disposal due to potential environmental and health impacts associated with halogenated compounds. Proper safety measures should be observed when working with this substance.
Formula:C7H3BrF4
InChI:InChI=1/C7H3BrF4/c8-5-1-4(7(10,11)12)2-6(9)3-5/h1-3H
SMILES:c1c(cc(cc1Br)F)C(F)(F)F
Synonyms:- 3-Bromo-5-Fluorotrifluoromethylbenzene
- 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene
- 3-Fluoro-5-(trifluoromethyl)bromobenzene
- 1-Bromo-3-(Trifluoromethyl)-5-Fluorobenzene
- 3,5-Bis(Trifluoromethyl)Benzenethiol
- 3-Fluoro-5-trifluoromethylbromobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzene, 1-bromo-3-fluoro-5-(trifluoromethyl)-
CAS:Formula:C7H3BrF4Purity:95%Color and Shape:LiquidMolecular weight:242.99633-Bromo-5-fluorobenzotrifluoride
CAS:3-Bromo-5-fluorobenzotrifluorideFormula:C7H3BrF4Purity:95%Color and Shape: faint red liquidMolecular weight:243.00g/mol3-Bromo-5-fluorobenzotrifluoride
CAS:Formula:C7H3BrF4Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:243.003-Bromo-5-fluorobenzotrifluoride
CAS:Formula:C7H3BrF4Purity:95%Color and Shape:LiquidMolecular weight:242.9993-Bromo-5-fluorobenzotrifluoride
CAS:Please enquire for more information about 3-Bromo-5-fluorobenzotrifluoride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C7H3BrF4Purity:Min. 95%Color and Shape:LiquidMolecular weight:243 g/mol





