CAS 1307233-94-8: N-[[2-(Chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester
Description:N-[[2-(Chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole moiety, a chloromethyl group, and a pyridine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The ethyl ester functional group suggests that it may have moderate lipophilicity, influencing its biological activity and absorption characteristics. The presence of the benzimidazole and pyridine rings may contribute to its potential pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's structure indicates potential for interactions with biological targets, which could be explored in drug development. As with many synthetic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine in its structure, which may pose hazards.
Formula:C20H21ClN4O3
InChI:InChI=1S/C20H21ClN4O3/c1-3-28-19(26)9-11-25(17-6-4-5-10-22-17)20(27)14-7-8-16-15(12-14)23-18(13-21)24(16)2/h4-8,10,12H,3,9,11,13H2,1-2H3
InChI key:InChIKey=ATDFBDBECQOWSX-UHFFFAOYSA-N
SMILES:O=C(OCC)CCN(C(=O)C=1C=CC2=C(N=C(N2C)CCl)C1)C3=NC=CC=C3
- Synonyms:
- N-((2-(Chloromethyl)-1-Methyl-1H-Benzimidazol-5-Yl)Carbonyl)-N-2-Pyridinyl-Beta-Alanine Ethyl Ester
- N-[[2-(Chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester
- β-Alanine, N-[[2-(chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-, ethyl ester

β-Alanine, N-[[2-(chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-, ethyl ester
Ref: IN-DA000UUJ
1g | 254.00 € | ||
250mg | 131.00 € |

N-[[2-(Chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridinyl-β-alanine ethyl ester
Ref: 54-OR1025681
1g | 281.00 € | ||
5g | 1,181.00 € | ||
100mg | 52.00 € | ||
250mg | 115.00 € |

Ethyl 3-(2-(chloromethyl)-1-methyl-N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate
Ref: 10-F752907
1g | To inquire | ||
250mg | To inquire |

Ethyl 3-[{[2-(chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl}(pyridin-2-yl)amino]propanoate
Ref: 3D-FE161387
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |