
CAS 1307239-66-2
:8-Fluoro-4-methyl-2-quinolinamine
Description:
8-Fluoro-4-methyl-2-quinolinamine is a chemical compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a fluorine atom at the 8-position and a methyl group at the 4-position of the quinoline ring contributes to its unique chemical properties. This compound is typically classified as an amine due to the presence of an amino group (-NH2) at the 2-position, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The fluorine substituent can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 8-Fluoro-4-methyl-2-quinolinamine is a compound of interest in research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C10H9FN2
InChI:InChI=1S/C10H9FN2/c1-6-5-9(12)13-10-7(6)3-2-4-8(10)11/h2-5H,1H3,(H2,12,13)
InChI key:InChIKey=JIHDDQKBKHXWJY-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(N)C1)C(F)=CC=C2
Synonyms:- 2-Quinolinamine, 8-fluoro-4-methyl-
- 8-Fluoro-4-methyl-2-quinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.