
CAS 1307239-67-3
:8-Ethoxy-4-methyl-2-quinolinamine
Description:
8-Ethoxy-4-methyl-2-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. This compound features an ethoxy group and a methyl group, contributing to its unique chemical properties. The presence of the amino group (-NH2) in the quinoline structure suggests potential basicity and reactivity, particularly in forming hydrogen bonds. The ethoxy group enhances its solubility in organic solvents, while the methyl group may influence its steric hindrance and electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and potential therapeutic effects. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity. Overall, 8-Ethoxy-4-methyl-2-quinolinamine represents a versatile structure with potential applications in various chemical and pharmaceutical fields.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-3-15-10-6-4-5-9-8(2)7-11(13)14-12(9)10/h4-7H,3H2,1-2H3,(H2,13,14)
InChI key:InChIKey=QFPBMXSTUDTZTJ-UHFFFAOYSA-N
SMILES:O(CC)C=1C2=C(C(C)=CC(N)=N2)C=CC1
Synonyms:- 8-Ethoxy-4-methyl-2-quinolinamine
- 2-Quinolinamine, 8-ethoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.