CAS 1307248-42-5

Spiro[piperidine-4,7′-[7H]thieno[2,3-c]pyran], 2′-chloro-4′,5′-dihydro-, hydrochloride (1:1)

Description:

Spiro[piperidine-4,7′-[7H]thieno[2,3-c]pyran], 2′-chloro-4′,5′-dihydro-, hydrochloride (1:1) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates a piperidine ring fused with a thieno[2,3-c]pyran moiety. This compound features a chlorine substituent at the 2′ position and exhibits a dihydro configuration, indicating partial saturation of the ring system. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. The presence of multiple heteroatoms, including nitrogen and sulfur, contributes to its potential biological activity, making it of interest in medicinal chemistry. Its structural complexity may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). As with many synthetic compounds, detailed studies would be necessary to fully elucidate its chemical behavior, reactivity, and potential therapeutic applications.

Formula: C₁₁H₁₄ClNOS·ClH

InChI: InChI=1S/C11H14ClNOS.ClH/c12-9-7-8-1-6-14-11(10(8)15-9)2-4-13-5-3-11;/h7,13H,1-6H2;1H

InChI key: InChIKey=MKWSNBCLILHOHD-UHFFFAOYSA-N

SMILES: ClC=1SC=2C3(OCCC2C1)CCNCC3.Cl

Synonyms:

• 2′-Chloro-4′,5′-dihydrospiro[piperidine-4,7′-thieno[2,3-c]pyran] hydrochloride
• Spiro[piperidine-4,7′-[7H]thieno[2,3-c]pyran], 2′-chloro-4′,5′-dihydro-, hydrochloride (1:1)

2'-Chloro-4',5'-dihydrospiro[piperidine-4,7'-thieno[2,3-c]pyran] hydrochloride

CAS: 1307248-42-5

Formula: C₁₁H₁₅Cl₂NOS

Molecular weight: 280.2139

Ref: IN-DA000UUG

2′-chloro-4′,5′-dihydrospiro[piperidine-4,7′-thieno[2,3-c]pyran] hydrochloride

CAS: 1307248-42-5

Formula: C₁₁H₁₅Cl₂NOS

Purity: 95.0%

Molecular weight: 280.21

Ref: 10-F496288