CAS 1307255-40-8

2-Fluoro-5-hydroxy-N-methoxy-N-methylbenzamide

Description:

2-Fluoro-5-hydroxy-N-methoxy-N-methylbenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a fluorine atom, which can influence its reactivity and biological activity, as well as a hydroxyl group that contributes to its polarity and potential for hydrogen bonding. The methoxy and methyl groups attached to the nitrogen atom enhance its lipophilicity, which may affect its solubility in organic solvents and biological systems. This compound is likely to exhibit properties typical of benzamides, such as potential pharmacological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom may also impart unique electronic properties, potentially influencing its interaction with biological targets. Overall, the combination of these functional groups suggests that 2-Fluoro-5-hydroxy-N-methoxy-N-methylbenzamide could be a versatile compound with applications in various fields, including pharmaceuticals and agrochemicals. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₉H₁₀FNO₃

InChI: InChI=1S/C9H10FNO3/c1-11(14-2)9(13)7-5-6(12)3-4-8(7)10/h3-5,12H,1-2H3

InChI key: InChIKey=DBSJDBKAJBTQHD-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C1=C(F)C=CC(O)=C1

Synonyms:

• 2-Fluoro-5-hydroxy-N-methoxy-N-methylbenzamide
• Benzamide, 2-fluoro-5-hydroxy-N-methoxy-N-methyl-