CAS 130727-41-2
:1-(9-MERCAPTONONYL)-3,6,9-TRIOXAUNDECAN-11-OL
Description:
1-(9-Mercaptononyl)-3,6,9-trioxaundecan-11-ol, with the CAS number 130727-41-2, is a chemical compound characterized by its unique structure that includes a long aliphatic chain, multiple ether linkages, and a terminal alcohol group. The presence of a mercapto group (-SH) introduces thiol characteristics, which can impart reactivity and potential for forming disulfide bonds. This compound is likely to exhibit hydrophilic properties due to the ether and alcohol functionalities, while the long hydrocarbon chain may contribute to hydrophobic characteristics. Such structural features suggest potential applications in fields like surfactants, emulsifiers, or as a stabilizing agent in various formulations. Additionally, the mercapto group may enhance the compound's ability to interact with metal ions or other reactive species, making it useful in coordination chemistry or as a ligand. Overall, the combination of functional groups in this compound suggests versatility in chemical reactivity and potential utility in various industrial and research applications.
Formula:C17H36O4S
InChI:InChI=1/C17H36O4S/c18-10-12-20-14-16-21-15-13-19-11-8-6-4-2-1-3-5-7-9-17-22/h18,22H,1-17H2
SMILES:C(CCCCCOCCOCCOCCO)CCCCCS
Synonyms:- Tri(Ethylene Glycol) Mono-11-Mercaptoun&
- 11-Mercaptoundecanoltriethyleneglycolether
- 2-(2-{2-[(11-Sulfanylundecyl)Oxy]Ethoxy}Ethoxy)Ethanol
- 2-[2-[2-(11-Mercaptoundecyloxy)ethoxy]ethoxy]ethanol
- Triethylene glycol mono-11-mercaptoundecyl ether,(11-Mercaptoundecyl)tri(ethylene glycol)
- Triethylene glycol Mono-11-Mercaptoundecyl ether 95%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Undecanethiol, 11-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-
CAS:Formula:C17H36O4SPurity:95%Color and Shape:LiquidMolecular weight:336.5303Thiol-C9-PEG4
CAS:<p>Thiol-C9-PEG4 is a PEG-based linker for PROTACs that covalently joins two ligands, enabling selective protein degradation via the ubiquitin-proteasome system.</p>Formula:C17H36O4SPurity:95.124%Color and Shape:SolidMolecular weight:336.531-(9-MERCAPTONONYL)-3,6,9-TRIOXAUNDECAN-11-OL
CAS:Formula:C17H36O4SPurity:97.0%Color and Shape:Liquid, No data available.Molecular weight:336.531-(9-Mercaptononyl)-3,6,9-trioxaundecan-11-ol
CAS:Controlled ProductFormula:C17H36O4SColor and Shape:NeatMolecular weight:336.53



