CymitQuimica logo

CAS 13073-28-4

:

3-BROMO-2-HYDROXYBENZONITRILE

Description:
3-Bromo-2-hydroxybenzonitrile, with the CAS number 13073-28-4, is an organic compound characterized by the presence of a bromine atom, a hydroxyl group, and a nitrile functional group attached to a benzene ring. This compound features a bromine substituent at the meta position relative to the hydroxyl group and a cyano group at the ortho position. The presence of the hydroxyl group imparts some degree of polarity, which can influence its solubility in various solvents. The nitrile group contributes to the compound's reactivity, making it useful in various chemical syntheses and applications. 3-Bromo-2-hydroxybenzonitrile may exhibit biological activity, and its derivatives are often explored in pharmaceutical research. Its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C7H4BrNO
InChI:InChI=1S/C7H4BrNO/c8-6-3-1-2-5(4-9)7(6)10/h1-3,10H
InChI key:BUWXNBPLRLEXOZ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)Br)O)C#N
Found 5 products.