CAS 13073-29-5
:6-Nitro-o-cresol
Description:
6-Nitro-o-cresol, with the CAS number 13073-29-5, is an organic compound that belongs to the class of nitrophenols. It features a nitro group (-NO2) and a methyl group (-CH3) attached to a benzene ring, specifically at the ortho positions relative to each other. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in water and higher solubility in organic solvents. 6-Nitro-o-cresol exhibits acidic properties due to the presence of the hydroxyl group (-OH) on the aromatic ring, which can participate in hydrogen bonding. It is primarily used in the synthesis of various chemical intermediates and has applications in the field of agrochemicals and pharmaceuticals. However, it is important to handle this substance with care, as it may pose environmental and health risks, including potential toxicity. Proper safety measures should be observed when working with or disposing of this compound.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,9H,1H3
SMILES:Cc1cccc(c1O)N(=O)=O
Synonyms:- 2-Methyl-6-nitrophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Phenol, 2-methyl-6-nitro-
CAS:Formula:C7H7NO3Purity:95%Color and Shape:SolidMolecular weight:153.13542-Methyl-6-nitrophenol
CAS:<p>2-Methyl-6-nitrophenol (2MP) is a nitro compound that has been shown to have an inhibitory effect on the oxidation of sodium nitrate by sodium chloride. It also inhibits the photooxidation of biomimetic systems. 2MP is a chemical ionization reagent that can be used as a molecular descriptor in environmental chemistry studies. The regioselectivity of 2MP was studied using gas chromatography and mass spectrometry. The molecular descriptors were determined using electron ionization and chemical ionization, which were found to be similar.</p>Formula:C7H7NO3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:153.14 g/mol
