CAS 13074-06-1
:L-Fucitol
Description:
L-Fucitol, also known as L-fucose or L-fucitol, is a naturally occurring sugar alcohol derived from L-fucose, a hexose monosaccharide. It is characterized by its white crystalline appearance and is soluble in water, making it readily available for various biochemical applications. L-Fucitol is known for its role in cellular processes and is often studied for its potential health benefits, including its involvement in cell signaling and immune response modulation. The substance has a sweet taste, which can be attributed to its sugar alcohol nature, and it is considered to have lower caloric content compared to traditional sugars. In terms of chemical properties, L-Fucitol has a specific molecular structure that includes hydroxyl groups, contributing to its solubility and reactivity. It is used in various fields, including food science, pharmaceuticals, and biochemistry, due to its functional properties. Additionally, L-Fucitol is of interest in research related to glycoproteins and polysaccharides, highlighting its significance in both industrial and academic settings.
Formula:C6H14O5
InChI:InChI=1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5+,6-/m0/s1
InChI key:InChIKey=SKCKOFZKJLZSFA-KCDKBNATSA-N
SMILES:[C@@H]([C@@H]([C@H](C)O)O)([C@@H](CO)O)O
Synonyms:- L-Galactitol, 6-deoxy-
- Galactitol, 1-deoxy-, D-
- 1-Deoxy-D-galactitol
- Fucitol, L-
- D-Galactitol, 1-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
L-Fucitol
CAS:<p>L-Fucitol (1-Deoxy-D-galactitol) is a galactitol analogue isolated from Myristica fragrans (Nutmeg), inhibits galactitol-positive strains of Escherichia coli</p>Formula:C6H14O5Purity:98.77%Color and Shape:SolidMolecular weight:166.171-Deoxy-D-galactitol
CAS:<p>1-Deoxy-D-galactitol</p>Purity:98%Color and Shape:CrystalsMolecular weight:166.17g/molL-Fucitol
CAS:Controlled ProductFormula:C6H14O5Color and Shape:White To Off-WhiteMolecular weight:166.17L-Fucitol
CAS:<p>L-Fucitol is a sugar that is found in the form of D-arabinose and D-xylitol. It is used in flow systems for the detection of herpes simplex virus type 1 (HSV1) glycoproteins and can be used to measure xylitol dehydrogenase activity. L-Fucitol has been shown to inhibit the growth of bacteria that are resistant to penicillin, ampicillin, and erythromycin. L-Fucitol also inhibits enzymes such as galactocerebrosidase, which breaks down galactocerebroside, a myelin constituent. This inhibition leads to accumulation of galactitol, an inhibitor of oligosaccharide synthesis. L-Fucitol also inhibits enzyme activities such as glycosidases and glycosyltransferases, which affect metabolic profiles by inhibiting the breakdown or synthesis of sugars. L-Fucitol is a monosac</p>Formula:C6H14O5Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:166.17 g/mol
