CAS 13074-06-1: L-Fucitol
Description:L-Fucitol, also known as L-fucose or L-fucitol, is a naturally occurring sugar alcohol derived from L-fucose, a hexose monosaccharide. It is characterized by its white crystalline appearance and is soluble in water, making it readily available for various biochemical applications. L-Fucitol is known for its role in cellular processes and is often studied for its potential health benefits, including its involvement in cell signaling and immune response modulation. The substance has a sweet taste, which can be attributed to its sugar alcohol nature, and it is considered to have lower caloric content compared to traditional sugars. In terms of chemical properties, L-Fucitol has a specific molecular structure that includes hydroxyl groups, contributing to its solubility and reactivity. It is used in various fields, including food science, pharmaceuticals, and biochemistry, due to its functional properties. Additionally, L-Fucitol is of interest in research related to glycoproteins and polysaccharides, highlighting its significance in both industrial and academic settings.
Formula:C6H14O5
InChI:InChI=1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5+,6-/m0/s1
InChI key:InChIKey=SKCKOFZKJLZSFA-KCDKBNATSA-N
SMILES:OCC(O)C(O)C(O)C(O)C
- Synonyms:
- L-Galactitol, 6-deoxy-
- Galactitol, 1-deoxy-, D-
- 1-Deoxy-D-galactitol
- Fucitol, L-
- D-Galactitol, 1-deoxy-
