CAS 130745-77-6
:3,3-BIS(4-CHLOROBENZYL)-2,4-PENTANEDIONE
Description:
3,3-Bis(4-chlorobenzyl)-2,4-pentanedione, identified by its CAS number 130745-77-6, is an organic compound characterized by its diketone structure, featuring two chlorobenzyl groups attached to a central pentanedione moiety. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, which is common for many diketones. Its molecular structure contributes to its potential applications in various fields, including organic synthesis and materials science. The presence of chlorine atoms in the chlorobenzyl groups enhances its reactivity and may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's diketone functionality allows for potential coordination with metal ions, which can be exploited in coordination chemistry. Safety data should be consulted for handling, as chlorinated compounds can pose health risks. Overall, 3,3-bis(4-chlorobenzyl)-2,4-pentanedione is a versatile compound with unique properties that can be utilized in diverse chemical applications.
Formula:C19H18Cl2O2
InChI:InChI=1/C19H18Cl2O2/c1-13(22)19(14(2)23,11-15-3-7-17(20)8-4-15)12-16-5-9-18(21)10-6-16/h3-10H,11-12H2,1-2H3
SMILES:CC(=O)C(Cc1ccc(cc1)Cl)(Cc1ccc(cc1)Cl)C(=O)C
Synonyms:- 3,3-Bis(4-chlorobenzyl)pentane-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2,4-Pentanedione, 3,3-bis[(4-chlorophenyl)methyl]-
CAS:Formula:C19H18Cl2O2Color and Shape:SolidMolecular weight:349.2513,3-Bis(4-chlorobenzyl)pentane-2,4-dione
CAS:<p>3,3-Bis(4-chlorobenzyl)pentane-2,4-dione</p>Molecular weight:349.25g/mol3,3-Bis(4-chlorobenzyl)-2,4-pentanedione
CAS:Controlled ProductFormula:C19H18Cl2O2Color and Shape:NeatMolecular weight:349.251


