CymitQuimica logo

CAS 130747-60-3

:

3-Pyridinecarbonitrile,1,6-dihydro-2-methoxy-6-oxo-(9CI)

Description:
3-Pyridinecarbonitrile, 1,6-dihydro-2-methoxy-6-oxo- (9CI), with the CAS number 130747-60-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methoxy group (–OCH3) and a keto group (C=O) indicates that it may exhibit specific chemical properties, such as hydrogen bonding and nucleophilicity. The dihydro form suggests that it has two hydrogen atoms added to the ring, which can influence its stability and reactivity. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could lead to various biological activities or serve as intermediates in the synthesis of more complex molecules. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used.
Formula:C7H6N2O2
InChI:InChI=1S/C7H6N2O2/c1-11-7-5(4-8)2-3-6(10)9-7/h2-3H,1H3,(H,9,10)
InChI key:FBTBUFBHIVYSKS-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=O)N1)C#N
Synonyms:
  • 3-Cyano-6-hydroxy-2-methoxypyridine
Found 4 products.