CAS 130753-13-8
:N-Cbz-Nortropinone
Description:
N-Cbz-Nortropinone, with the CAS number 130753-13-8, is a chemical compound that belongs to the class of tropinones, which are derivatives of tropane. This substance is characterized by the presence of a carbobenzyloxy (Cbz) protecting group, which enhances its stability and solubility in organic solvents. The compound typically exhibits a white to off-white crystalline appearance and is soluble in various organic solvents, making it suitable for use in organic synthesis and medicinal chemistry. N-Cbz-Nortropinone is often utilized as an intermediate in the synthesis of various pharmaceuticals and bioactive compounds due to its structural features that allow for further functionalization. Its reactivity is influenced by the ketone functional group, which can participate in nucleophilic addition reactions. Additionally, the presence of the Cbz group can facilitate selective reactions, making it a valuable building block in synthetic organic chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C15H17NO3
InChI:InChI=1/C15H17NO3/c17-14-8-12-6-7-13(9-14)16(12)15(18)19-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2
SMILES:c1ccc(cc1)COC(=O)N1C2CCC1CC(=O)C2
Synonyms:- N-Cbz-Notropinone
- Benzyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate
- N-Benzyloxycarbonylnortropinone
- Benzyl (1S)-3-Oxo-8-Azabicyclo[3.2.1]Octane-8-Carboxylate
- 3-Oxo-8-Aza-Bicyclo[3.2.1]Octane-8-Carboxylic Acid Benzyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-oxo-, phenylmethyl ester
CAS:Formula:C15H17NO3Purity:97%Color and Shape:LiquidMolecular weight:259.3004Benzyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate
CAS:Formula:C15H17NO3Purity:98%Color and Shape:SolidMolecular weight:259.305N-Cbz-4-nortropinone
CAS:Please enquire for more information about N-Cbz-4-nortropinone including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C15H17NO3Purity:Min. 95%Molecular weight:259.3 g/mol



