CAS 1307683-82-4

N-[1-(Phenylmethyl)-3-azetidinyl]acetamide

Description:

N-[1-(Phenylmethyl)-3-azetidinyl]acetamide, identified by its CAS number 1307683-82-4, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and is substituted with a phenylmethyl group and an acetamide functional group. This compound is likely to exhibit properties typical of amides, such as moderate polarity and potential hydrogen bonding capabilities due to the presence of the acetamide moiety. The phenylmethyl group contributes to its hydrophobic characteristics, which may influence its solubility in organic solvents. Additionally, the azetidine ring can impart specific steric and electronic properties that may affect its reactivity and interaction with biological targets. Such compounds may be of interest in medicinal chemistry for their potential pharmacological activities, although specific biological data would be necessary to elucidate their therapeutic potential. Overall, N-[1-(Phenylmethyl)-3-azetidinyl]acetamide represents a class of compounds that could be explored for various applications in drug development and chemical synthesis.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1S/C12H16N2O/c1-10(15)13-12-8-14(9-12)7-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,13,15)

InChI key: InChIKey=MBOIHVWADTUKKI-UHFFFAOYSA-N

SMILES: C(N1CC(NC(C)=O)C1)C2=CC=CC=C2

Synonyms:

• N-[1-(Phenylmethyl)-3-azetidinyl]acetamide
• Acetamide, N-[1-(phenylmethyl)-3-azetidinyl]-