CymitQuimica logo

CAS 130769-54-9

:

Glycine, monohydrate

Description:
Glycine monohydrate, with the CAS number 130769-54-9, is a crystalline form of glycine, the simplest amino acid, which is essential for protein synthesis. It is characterized by its white, odorless appearance and is highly soluble in water, making it suitable for various applications in biochemistry and pharmaceuticals. Glycine itself is a non-polar, aliphatic amino acid with a molecular formula of C2H5NO2, and the monohydrate form indicates the presence of one water molecule per glycine molecule, which can influence its physical properties and stability. Glycine monohydrate is often used as a buffering agent, a sweetener in food products, and in the formulation of dietary supplements. Additionally, it plays a role in neurotransmission and is involved in the synthesis of other biomolecules. Its low toxicity and biocompatibility make it a valuable compound in research and industrial applications.
Formula:C2H5NO2·H2O
InChI:InChI=1S/C2H5NO2.H2O/c3-1-2(4)5;/h1,3H2,(H,4,5);1H2
InChI key:InChIKey=RUECTJATXCACED-UHFFFAOYSA-N
SMILES:C(CN)(O)=O.O
Synonyms:
  • Glycine, monohydrate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.