CAS 130775-64-3

3-[5-(chloromethyl)isoxazol-3-yl]pyridine

Description:

3-[5-(Chloromethyl)isoxazol-3-yl]pyridine, with the CAS number 130775-64-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and an isoxazole moiety. The presence of the chloromethyl group on the isoxazole enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is typically used in medicinal chemistry and research due to its biological activity and potential therapeutic applications. Its molecular structure contributes to its properties, such as solubility and stability, which can vary depending on the solvent and environmental conditions. The compound may exhibit specific interactions with biological targets, making it of interest in drug development. Additionally, safety and handling precautions should be observed due to the presence of chlorine, which can pose hazards. Overall, 3-[5-(chloromethyl)isoxazol-3-yl]pyridine is a versatile compound with significant implications in chemical research and pharmaceutical applications.

Formula: C₉H₇ClN₂O

InChI: InChI=1/C9H7ClN2O/c10-5-8-4-9(12-13-8)7-2-1-3-11-6-7/h1-4,6H,5H2

SMILES: c1cc(cnc1)c1cc(CCl)on1