CAS 13079-19-1

2-Amino-1-(3,4,5-trimethoxyphenyl)ethanone

Description:

2-Amino-1-(3,4,5-trimethoxyphenyl)ethanone, with the CAS number 13079-19-1, is an organic compound characterized by the presence of an amino group and a ketone functional group. This compound features a phenyl ring that is substituted with three methoxy groups at the 3, 4, and 5 positions, which significantly influences its chemical properties and reactivity. The presence of these methoxy groups enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. The amino group contributes to its basicity and potential for forming hydrogen bonds, which can be relevant in interactions with biological targets. Additionally, the ethanone moiety indicates that it can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Overall, 2-Amino-1-(3,4,5-trimethoxyphenyl)ethanone is a compound of interest for research in organic synthesis and pharmacology, particularly due to its structural features that may confer specific biological activities.

Formula: C₁₁H₁₅NO₄

InChI: InChI=1S/C11H15NO4/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3/h4-5H,6,12H2,1-3H3

InChI key: InChIKey=KWZWUFCLUMUDRD-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=C(C(CN)=O)C=C1OC

Synonyms:

• 2-Amino-1-(3,4,5-trimethoxyphenyl)ethanone
• 2-Amino-1-(3,4,5-trimethoxyphenyl)ethan-1-one
• Ethanone, 2-amino-1-(3,4,5-trimethoxyphenyl)-
• Acetophenone, 2-amino-3′,4′,5′-trimethoxy-